Fmoc-Cya-OH disodium salt
Fmoc-Cya-OH disodium salt is a protected derivative for the introduction of this highly polar amino acid. Cya-containing peptides are obtained by oxidation of cysteine or cystine, as a post-translational modification, as a by-product of peptide synthesis, or intentionally (by using oxidants such as H2O2/formic acid), for quantification of these sensitive amino acids.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015273 |
| Pricing | Inquire |
| Cas | 320384-09-6 |
| Molecular Weight | 435.37 |
| Molecular Formula | C18H15NNa2O7S |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CS(=O)(=O)[O-])C(=O)[O-].[Na+].[Na+] |