2'-O-tert-Butyldimethylsilyl-3'-deoxy-5-methyluridine
2'-O-tert-Butyldimethylsilyl-3'-deoxy-5-methyluridine is a crucial compound used in the biomedical industry. It plays a vital role in the synthesis of novel antiviral drugs specifically designed to target viral infections caused by diseases such as influenza and HIV. This compound's unique structure and properties contribute to the development of effective therapeutics against these viral pathogens.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1622941-62-1 |
| Pricing | Inquire |
| Cas | 1622941-62-1 |
| Molecular Weight | 356.49 |
| Molecular Formula | C16H28N2O5Si |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(CC(O2)CO)O[Si](C)(C)C(C)(C)C |