TRIS(2-CARBOXYETHYL) ISOCYANURATE 99+%
TRIS(2-CARBOXYETHYL) ISOCYANURATE 99+% is an essential compound used in the biomedical industry. With its high purity level of 99+%, this product is widely utilized in the synthesis of drugs for treating various diseases. Its versatile properties make it an effective component in the development of pharmaceuticals aimed at combating different ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2904-41-8 |
| Pricing | Inquire |
| Cas | 2904-41-8 |
| Molecular Weight | 345.26 |
| Molecular Formula | C12H15N3O9 |
| Canonical SMILES | C(CN1C(=O)N(C(=O)N(C1=O)CCC(=O)O)CCC(=O)O)C(=O)O |