Seldomycin 1
Seldomycin 1 is an aminoglycoside antibiotic produced by the strain of Str. hofunensis nor. sp.. It has a broad spectrum of antimicrobial activity, and Seldomycin F5 has the strongest antimicrobial activity. It is cross-resistant to E. coli with aminoglycoside antibiotic passivation enzyme (such as APH (3')-Ⅰ, APH(3')-II, AAC(6'), AAC(2)). ED50 is greater than 1000 mg/kg (abdominal infection in mice, intravenous administration).
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02896 |
| Pricing | Inquire |
| Cas | 56276-04-1 |
| Molecular Weight | 454.47 |
| Molecular Formula | C17H34N4O10 |
| Canonical SMILES | C1C(C(C(C(C1N)OC2C(C(C(C(O2)CO)O)O)N)O)OC3C(C(C(CO3)O)O)N)N |