3,4,5-Trifluorophenylboronic Acid
Reactant involved in: Preparation of phenylboronic catechol esters and determination of Lewis acidity; Synthesis of benzopyranone derivatives as GABAA receptor modulators; Synthesis of multisubstituted olefins and conjugate dienes; Suzuki cross-coupling reactions; Preparation of fluorinated aromatic poly(ether-amide)s.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB009597 |
| Pricing | Inquire |
| Cas | 143418-49-9 |
| Molecular Weight | 175.90 |
| Molecular Formula | C6H4F3O2B |
| Canonical SMILES | B(C1=CC(=C(C(=C1)F)F)F)(O)O |