N6-Benzoyl-2'-O,4'-C-methyleneadenosine
N6-Benzoyl-2'-O,4'-C-methyleneadenosine, a highly efficacious agent employed in the realm of biomedicine due to its remarkable anticancer attributes, stands out in the selective eradication of malignant cells via the potent suppression of neoplastic cell proliferation and the initiation of programmed cell death. Notably, this product holds immense potential for the advancement of avant-garde therapeutic strategies devoted to diverse cancer types, encompassing breast, lung, and prostate cancer. Its exceptional mode of action lies in the targeted inhibition of specific enzymes and pathways vital in the malignant cascade, rendering it an exceedingly auspicious contender for antineoplastic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 209968-94-5 |
| Pricing | Inquire |
| Cas | 209968-94-5 |
| Molecular Weight | 383.36 |
| Molecular Formula | C18H17N5O5 |
| Canonical SMILES | C1C2(C(C(O1)C(O2)N3C=NC4=C(N=CN=C43)NC(=O)C5=CC=CC=C5)O)CO |