Ganoderenic acid B
Ganoderenic acid B is an inherent constituent within Ganoderma lucidum unveiling a plethora of multifaceted anticancer properties, anti-inflammatory prowess and immunomodulatory efficacy. This natural compound, incredibly sought after, empowers the development of groundbreaking pharmaceuticals that selectively study cancer, mitigate inflammation and study immune-related afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100665-41-6 |
| Pricing | Inquire |
| Cas | 100665-41-6 |
| Molecular Weight | 514.6 |
| Molecular Formula | C30H42O7 |
| Canonical SMILES | CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O |