Compound W
Compound W, also called 3,5-bis(4-Nitrophenoxy)benzoic acid, a 3,3'-diiodothyronine sulfate cross-reactive substance, is an inhibitor of γ-secretase which causes a decrease in the released levels of Aβ42 and notch-1 Aβ-like peptide 25 (Nβ25).
| Supplier | BOC Sciences |
|---|---|
| Product # | 173550-33-9 |
| Pricing | Inquire |
| Cas | 173550-33-9 |
| Molecular Weight | 396.31 |
| Molecular Formula | C19H12N2O8 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC(=CC(=C2)C(=O)O)OC3=CC=C(C=C3)[N+](=O)[O-] |