Urantide acetate
Urantide acetate is a selective and competitive urotensin-II (UT) receptor antagonist (pKB = 8.3) that blocks hU-II-induced contractions in the thoracic aorta ex vivo. Urantide has no effect on noradrenaline or endothelin 1-induced contraction or on acetylcholine-induced relaxation. Urantide also exhibits partial agonist activity in a calcium mobilization assay (in CHO cells expressing hUT receptors).
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016280 |
| Pricing | Inquire |
| Molecular Weight | 1135.32 |
| Molecular Formula | C53H70N10O14S2 |
| Canonical SMILES | CC(C)C(C(=O)O)NC(=O)C1CSSC(C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)CCCN)CC3=CNC4=CC=CC=C43)CC5=CC=CC=C5)NC(=O)C(CC(=O)O)N)(C)C.CC(=O)O |