Gliadorphin-7
Gliadorphin-7, an opioid peptide, is formed during the digestion of the gliadin component of the gluten protein. Elevated concentration of gliadorphin-7 due to inadequate proteolysis has been linked to autism, schizophrenia, and celiac disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-014573 |
| Pricing | Inquire |
| Cas | 107936-65-2 |
| Molecular Weight | 875.98 |
| Molecular Formula | C43H57N9O11 |
| Canonical SMILES | C1CC(N(C1)C(=O)C(CCC(=O)N)NC(=O)C2CCCN2C(=O)C(CC3=CC=C(C=C3)O)N)C(=O)NC(CCC(=O)N)C(=O)N4CCCC4C(=O)NC(CC5=CC=CC=C5)C(=O)O |