5-Bromo-3-indolyl phosphate disodium salt
5-Bromo-3-indolyl phosphate disodium salt, an essential biochemical compound well-established within the biomedicine industry, assumes the crucial role of serving as a substrate for the discernment of phosphatase activity. Its proven efficacy is not limited to enzymatic assays, but extends to invaluable applications such as the identification of tissue-specific gene expression and the comprehensive investigation of intricate signaling pathways related to diverse afflictions encompassing cancer and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16036-59-2 |
| Pricing | Inquire |
| Cas | 16036-59-2 |
| Molecular Weight | 335.99 |
| Molecular Formula | C8H5BrNO4PNa2 |
| Canonical SMILES | C1=CC2=C(C=C1Br)C(=CN2)OP(=O)([O-])[O-].[Na+].[Na+] |