Paulomycin B
It is produced by the strain of Str. paulus 273. It has anti-gram-positive bacteria effect, and it has inhibitory effect on staphylococcus aureus resistant to penicillin, streptomycin, neomycin and macrolide antibiotics. The antibacterial activity of Paulomycin A, A1 and B are stronger than other components.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02376 |
| Pricing | Inquire |
| Cas | 81988-76-3 |
| Molecular Weight | 772.77 |
| Molecular Formula | C33H44N2O17S |
| Canonical SMILES | CC=C(C(=O)OC1C(OC(C(C1OC2CC(C(C(O2)C)(C(C)OC(=O)C(C)C)O)OC)O)C3(CC(=O)C(=N)C(=C3O)C(=O)O)O)COC(=O)C)N=C=S |