Mycophenolic acid
Mycophenolic acid is a small lactone antibiotic produced by Pen. brevicom pactum and Pen. stoloniferum. Activity against gram-positive bacteria. In animal experiments, it has inhibitory effect on sarcoma-180, Lewis lung cancer, adenocarcinoma Ca-755, Walker tumor 256, Yoshida sarcoma, Freund ascites tumor, etc. Mycophenolic acid is a potent IMPDH inhibitor and the active metabolite of an immunosuppressive drug, used to prevent rejection in organ transplantation. It inhibits an enzyme needed for the growth of T cells and B cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02567 |
| Pricing | Inquire |
| Cas | 24280-93-1 |
| Molecular Weight | 320.34 |
| Molecular Formula | C17H20O6 |
| Canonical SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)CC=C(C)CCC(=O)O)O |