Aminoallyl-dUTP
Aminoallyl-dUTP is a frequently employed nucleotide analog in the realm of molecular biology exploration, serving as a substrate for DNA polymerases and DNA labeling reactions, specifically the notable fluorescent in situ hybridization (FISH). Upon incorporation into DNA, this peculiar compound expedites the discernment and depiction of distinct DNA sequences within diverse applications, thereby aiding in the visualization and detection processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 90015-82-0 |
| Pricing | Inquire |
| Cas | 90015-82-0 |
| Molecular Weight | 523.22 |
| Molecular Formula | C12H20N3O14P3 |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=O)NC2=O)C=CCN)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |