18:1 Ptd Ethylene Glycol (sodium salt)
18:1 Ptd Ethylene Glycol (sodium salt) is used in the biomedical industry for the treatment of various diseases such as cancer, diabetes, and neurological disorders. Acts as a therapeutic agent targeting specific cellular pathways for effective disease management.
| Supplier | BOC Sciences |
|---|---|
| Product # | 474923-51-8 |
| Pricing | Inquire |
| Cas | 474923-51-8 |
| Molecular Weight | 767.00 |
| Molecular Formula | C41H76NaO9P |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCCO)OC(=O)CCCCCCCC=CCCCCCCCC.[Na+] |