Prednisone Impurity 2
An impurity of Prednisone.Prednisone is a synthetic corticosteroid drug. It can be used for the treatment of certain inflammatory diseases, some autoimmune diseases, and (at higher doses) some types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38680-83-0 |
| Pricing | Inquire |
| Cas | 38680-83-0 |
| Molecular Weight | 400.48 |
| Molecular Formula | C23H28O6 |
| Canonical SMILES | CC(=O)OCC(=O)C1(CCC2C1(CC3C4(C2CCC5=CC(=O)C=CC54C)O3)C)O |