Methyl 2-Benzyl-5-hydroxy-2H-pyrazole-3-carboxylate
Methyl 2-benzyl-5-hydroxy-2H-pyrazole-3-carboxylate is an intermediate for the synthesis of CFM 1571 Hydrochloride (C291720), which acts as a soluble guanylyl cyclase (sGC) activator while ignoring adenylyl cyclase. Inhibits collagen-stimulated platelet aggregation in vitro.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076359 |
| Pricing | Inquire |
| Cas | 52867-49-9 |
| Molecular Weight | 232.24 |
| Molecular Formula | C12H12N2O3 |
| Canonical SMILES | COC(=O)C1=CC(=O)NN1CC2=CC=CC=C2 |