Fosmidomycin sodium salt
Fosmidomycin is an antimalarial and antibiotic originally isolated from culture broths of bacteria of the genus Streptomyces and has been used as an inhibitor of DOXP reductoisomerase, a key enzyme in the non-mevalonate pathway of isoprenoid biosynthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66508-37-0 |
| Pricing | Inquire |
| Cas | 66508-37-0 |
| Molecular Weight | 205.08 |
| Molecular Formula | C4H9NO5P.Na |
| Canonical SMILES | C(CN(C=O)O)CP(=O)(O)[O-].[Na+] |