Dasatinib N-Oxide-[d8]
Dasatinib N-Oxide-[d8], is the labelled analogue of Dasatinib N-Oxide, which is an oxidative metabolite of Dasatinib. Dasatinib is a targeted therapy used to treat certain cases of chronic myelogenous leukemia and acute lymphoblastic leukemia.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002447 |
| Pricing | Inquire |
| Cas | 1189988-36-0 |
| Molecular Weight | 512.05 |
| Molecular Formula | C22H18D8ClN7O3S |
| Canonical SMILES | CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=CC(=NC(=N3)C)N4CC[N+](CC4)(CCO)[O-] |