5-[2-(2,3-Dimethylphenyl)ethyl]-1H-imidazole
5-[2-(2,3-Dimethylphenyl)ethyl]-1H-imidazole is an exceptionally robust chemical compound, showcasing remarkable anti-inflammatory attributes. This compound, ingeniously incorporated into a multitude of pharmaceutical preparations, specifically caters to studying the burdensome consequences of incessant inflammatory ailments, namely the distressing conditions of rheumatoid arthritand inflammatory bowel disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 79924-14-4 |
| Pricing | Inquire |
| Cas | 79924-14-4 |
| Molecular Weight | 200.29 |
| Molecular Formula | C13H16N2 |
| Canonical SMILES | N1=CNC(=C1)CCC=2C=CC=C(C2C)C |