K-(D-1-Nal)-FwLL-NH2
| Supplier | Creative Peptides |
|---|---|
| Product # | R0816 |
| CAS # | 1394288-22-2 |
| Pricing | Inquire |
| LabelingTarget | Ghrelin receptor |
| MolecularFormula | C51H67N9O6 |
| MolecularWeight | 902.13 |
| Sequence | KXFWLL(Modifications: X=D-1-Nal,Trp-4 = D-Trp, Leu-6 = C-terminal amide) |
| Storage | -20°C |
| Explanation | K-(D-1-Nal)-FwLL-NH2 is a high affinity and potent ghrelin receptor inverse agonist (Ki values are 4.9 and 31 nM in COS7 and HEK293T cells, respectively), which blocks ghrelin receptor-mediated Gq- and G13-dependent signaling pathways. |
| Application | K-(D-1-Nal)-FwLL-NH2 is an inverse agonist of the ghrelin receptor. |
| Activity | Agonist |
| InChI | InChI=1S/C51H67N9O6/c1-31(2)25-41(46(54)61)56-48(63)42(26-32(3)4)58-51(66)45(29-36-30-55-40-23-11-10-21-38(36)40)60-49(64)43(27-33-15-6-5-7-16-33)59-50(65)44(57-47(62)39(53)22-12-13-24-52)28-35-19-14-18-34-17-8-9-20-37(34)35/h5-11,14-21,23,30-32,39,41-45,55H,12-13,22,24-29,52-53H2,1-4H3,(H2,54,61)(H,56,63)(H,57,62)(H,58,66)(H,59,65)(H,60,64)/t39-,41-,42-,43-,44+,45+/m0/s1 |
| InChIKey | NCMQVOQOKBIHPA-MHRDGXECSA-N |
| IsomericSMILES | CC(C)C[C@@H](C(=O)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC1=CNC2=CC=CC=C21)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)[C@@H](CC4=CC=CC5=CC=CC=C54)NC(=O)[C@H](CCCCN)N |
| Purity | >98 % |