6-Azido-6-deoxy-D-galactose
6-Azido-6-deoxy-D-galactose is a versatile compound used in the biomedical industry for various applications acting as a key intermediate in the research and development of carbohydrate-based drugs and probes. With its unique azide group, it enables bioorthogonal chemical reactions for the labeling and detection of biomolecules.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66927-03-5 |
| Pricing | Inquire |
| Cas | 66927-03-5 |
| Molecular Weight | 205.17 |
| Molecular Formula | C6H11N3O5 |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)N=[N+]=[N-] |