3-O-[2-(Acetamino)-2-deoxy-D-galactopyranosyl]-D-mannopyranose
3-O-[2-(Acetamino)-2-deoxy-D-galactopyranosyl]-D-mannopyranose is a paramount compound harnessed within the biomedical sector assuming an indispensable function in the development of therapeutic agents research of diverse ailments. This compound finds pervasive utility when formulating medications tailored to combat precise afflictions or conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 197457-62-8 |
| Pricing | Inquire |
| Cas | 197457-62-8 |
| Molecular Weight | 383.35 |
| Molecular Formula | C14H25NO11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2C(C(OC(C2O)O)CO)O)CO)O)O |