(3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate
(3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate is a pharmaceutical intermediate used in the preparation of Docetaxel, which is a semisynthetic derivative of Paclitaxel used to treat a variety of cancers, including breast, head and neck, stomach, prostate, and non-small cell lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149198-47-0 |
| Pricing | Inquire |
| Cas | 149198-47-0 |
| Molecular Weight | 377.55 |
| Molecular Formula | C20H31NO4Si |
| Canonical SMILES | CC[Si](CC)(CC)OC1C(N(C1=O)C(=O)OC(C)(C)C)C2=CC=CC=C2 |