1,2,3,4-Tetra-O-acetyl-b-L-rhamopyranose
1,2,3,4-Tetra-O-acetyl-b-L-rhamopyranose, derived from rhamnose, a saccharide, exhibits a range of applications due to its diverse potential functionalities. The compound's proficiency in synthesizing glycosides with medicinal attributes has been well-established. Predominantly, it is utilized as an initiating element in the production of bioactive agents, such as antibiotics, among other desired biological molecules.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27821-10-9 |
| Pricing | Inquire |
| Cas | 27821-10-9 |
| Molecular Weight | 332.3 |
| Molecular Formula | C14H20O9 |
| Canonical SMILES | CC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |