2'-Deoxycytidine 3'-monophosphate ammonium salt
2'-Deoxycytidine 3'-monophosphate ammonium salt is a nucleotide-like compound that is extensively employed in scientific research, especially in the disciplines of DNA sequencing and synthesis. Furthermore, it serves as an essential ingredient for various phosphatases and kinases. With its unique properties, it has the potential to combat a variety of viral infections and cancers, thus opening up new avenues for therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2001-297040 |
| Pricing | Inquire |
| Cas | 102783-50-6 |
| Molecular Weight | 324.23 |
| Molecular Formula | C9H17N4O7P |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)CO)OP(=O)(O)O.N |