Bis-PEG3-acid
Bis-PEG3-acid is a PEG linker containing two terminal carboxylic acid groups. The terminal carboxylic acids can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-500484 |
| Pricing | Inquire |
| Cas | 96517-92-9 |
| Molecular Weight | 250.25 |
| Molecular Formula | C10H18O7 |
| Canonical SMILES | C(COCCOCCOCCC(=O)O)C(=O)O |