V-9302
V-9302 is a competitive antagonist of transmembrane glutamine flux, which selectively and potently targets the amino acid transporter ASCT2 (SLC1A5) with IC50 value of 9.6 μM for inhibition of glutamine uptake in HEK-293 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1855871-76-9 |
| Pricing | Inquire |
| Cas | 1855871-76-9 |
| Molecular Weight | 538.68 |
| Molecular Formula | C34H38N2O4 |
| Canonical SMILES | CC1=CC(=CC=C1)COC2=CC=CC=C2CN(CCC(C(=O)O)N)CC3=CC=CC=C3OCC4=CC=CC(=C4)C |