5'-O-Acetyl-2',3'-dideoxyinosine
5'-O-Acetyl-2',3'-dideoxyinosine is an extensively utilized potent antiviral compound within the biomedical field, exhibiting impressive efficacy in research of viral infections induced by the human immunodeficiency virus (HIV). By impeding the reverse transcriptase enzyme, a pivotal factor for viral replication, this compound effectively impedes viral multiplication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 130676-58-3 |
| Pricing | Inquire |
| Cas | 130676-58-3 |
| Molecular Weight | 278.26 |
| Molecular Formula | C12H14N4O4 |
| Canonical SMILES | CC(=O)OCC1CCC(O1)N2C=NC3=C2N=CNC3=O |