1-METHYL-3-TRIFLUOROMETHYLPYRAZOLE-5-BORONIC ACID
1-Methyl-3-trifluoromethylpyrazole-5-boronic Acid is a reagent commonly employed in biomedical research. Notably, it serves as an intermediate in the synthesis of pharmaceuticals, especially drugs targeting oncological diseases, leveraging its ability to bind with proteins easily.
| Supplier | BOC Sciences |
|---|---|
| Product # | 344591-91-9 |
| Pricing | Inquire |
| Cas | 344591-91-9 |
| Molecular Weight | 193.9195496 |
| Molecular Formula | C5H6BF3N2O2 |
| Canonical SMILES | B(C1=CC(=NN1C)C(F)(F)F)(O)O |