EI-2128-1
EI-2128-1 is originally isolated from Penicillum sp. E-2128. It selectively inhibited ICE, and the IC50 of recombinant human ICE was 0.59 μmol/L. It also has anti-Gram-positive bacteria such as Bacillus subtilis, Staphylococcus aureus and Enterococcus enterococcus.
Supplier | BOC Sciences |
---|---|
Product # | BBF-02815 |
Pricing | Inquire |
Molecular Weight | 421.53 |
Molecular Formula | C23H35NO6 |
Canonical SMILES | CCCCCCC(C)CC(C)C=CC(=O)NC1CC2(C3C(O3)C(=O)C4C2O4)OC1O |