Gastric Inhibitory Polypeptide (6-30) amide (human)
Gastric Inhibitory Polypeptide (6-30) amide (human), a porcine homolog, antagonizes the induction of cAMP production of gastric inhibitory polypeptide (human) (GIP human) in vitro. Competitive binding studies showed that it exhibited a receptor-binding affinity equivalent to the gastric inhibitory polypeptide (human) with an IC50 of 3.08±0.57 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-014507 |
| Pricing | Inquire |
| Cas | 1139691-72-7 |
| Molecular Weight | 3010.42 |
| Molecular Formula | C139H209N35O38S |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC1=CN=CN1)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC(=O)O)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(C(C)C)C(=O)NC(CC(=O)N)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCCCN)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CC(=O)O)NC(=O)C(CCSC)NC(=O)C(C)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(CC5=CC=C(C=C5)O)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(C(C)CC)NC(=O)C(CC6=CC=CC=C6)N |