CKI 7 dihydrochloride
CKI 7 is a CK1 inhibitor, and also inhibits SGK, S6K1 and MSK1. In combination with SB 431542, CKI 7 was shown to induce retinal cell differentiation from human ESCs and iPSCs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1177141-67-1 |
| Pricing | Inquire |
| Cas | 1177141-67-1 |
| Molecular Weight | 358.67 |
| Molecular Formula | C11H14Cl3N3O2S |
| Canonical SMILES | C1=CC(=C2C=CN=CC2=C1S(=O)(=O)NCCN)Cl.Cl.Cl |