Azure B
Azure B is used for staining semi-thin sections of plant tissue. This dye is also useful in the NCCLS method for blood smears and Lillie's modified Nocht's method for paraffin sections. Azure B is a high-potency, selective and reversible inhibitor of monoamine oxidases (MAO)-A, with IC50s of 11 and 968 nM for recombinant human MAO-A and MAO-B, respectively. Azure B possesses significant antidepressant-like effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 531-55-5 |
| Pricing | Inquire |
| Cas | 531-55-5 |
| Molecular Weight | 305.83 |
| Molecular Formula | C15H16ClN3S |
| Canonical SMILES | CNC1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |