PROTAC CDK2/9 Degrader-1
PROTAC CDK2/9 Degrader-1 is a potent dual degrader for CDK2 (DC50 = 62 nM) and CDK9 (DC50 = 33 nM), which inhibits the proliferation of prostate cancer PC-3 cells (IC50 = 0.12 µM) by effectively blocking the S and G2/M cell cycles. It is a PROTAC by tethering CDK inhibitor with Cereblon ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2408641-24-5 |
| Pricing | Inquire |
| Cas | 2408641-24-5 |
| Molecular Weight | 815.84 |
| Molecular Formula | C40H41N13O7 |
| Canonical SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCNC(=O)CCC(=O)N4CCN(CC4)CC5=CC=C(C=C5)NC(=O)C6=C(C=NN6)NC7=NC=NC8=C7C=CN8 |