5'-Azido-5'-deoxy-5-methyluridine
5'-Azido-5'-deoxy-5-methyluridine is a vital compound used in compound commonly utilized in research studies involving nucleotide modification and nucleic acid labeling. It is frequently employed as a precursor to produce modified RNA molecules via click chemistry. Additionally, this compound finds applications in developing antiviral drugs targeting certain illnesses caused by RNA viruses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1187022-65-6 |
| Pricing | Inquire |
| Cas | 1187022-65-6 |
| Molecular Weight | 283.24 |
| Molecular Formula | C10H13N5O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CN=[N+]=[N-])O)O |