Octafluoroadipic acid
Octafluoroadipic acid is a highly significant chemical compound actively utilized within the expansive realms of the biomedical industry. Its multifarious applications encompass the efficacious therapeutic intervention rendered amidst an array of afflictions and irregularities. Rigorous investigations of this product's potential for novel drug development to decisively confront infections, malignancies, and cognition-related maladies have been consistently pursued. The unprecedented attributes inherent to this compound unequivocally establish its indispensability as a cardinal constituent employed in the synthesis of medicinal agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 336-08-3 |
| Pricing | Inquire |
| Cas | 336-08-3 |
| Molecular Weight | 290.06 |
| Molecular Formula | C6H2F8O4 |
| Canonical SMILES | C(=O)(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)O |