Monensin B
Monensin B is an oxygen-containing heterocyclic polyether antibiotic produced by Str. cinnamonensis. It has antibacterial, mycobacterial, fungal and protozoan activity, but it has a weaker effect on gram-negative bacteria and has an inhibitory effect on HeLa cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01958 |
| Pricing | Inquire |
| Cas | 30485-16-6 |
| Molecular Weight | 656.84 |
| Molecular Formula | C35H60O11 |
| Canonical SMILES | CC1CC(C(OC1C2CC(C(O2)C3(CCC(O3)C4(CCC5(O4)CC(C(C(O5)C(C)C(C(C)C(=O)O)OC)C)O)C)C)C)(CO)O)C |