Alfacalcidol EP Impurity C
Alfacalcidol EP Impurity C is an impurity of Alfacalcidol, which is a non-selective VDR activator medication. Alfacalcidol improves mechanical bone strength and bone mass and suppresses osteoclastic bone resorption in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82266-85-1 |
| Pricing | Inquire |
| Cas | 82266-85-1 |
| Molecular Weight | 575.78 |
| Molecular Formula | C35H49N3O4 |
| Canonical SMILES | CC1=C(CC(CC1O)O)C2C=C3C4CCC(C4(CCC3N5N2C(=O)N(C5=O)C6=CC=CC=C6)C)C(C)CCCC(C)C |