Seldomycin 5
Seldomycin 5 is an aminoglycoside antibiotic produced by the strain of Str. hofunensis nor. sp.. It has a broad spectrum of antimicrobial activity, and Seldomycin F5 has the strongest antimicrobial activity. It is cross-resistant to E. coli with aminoglycoside antibiotic passivation enzyme (such as APH (3')-Ⅰ, APH(3')-II, AAC(6'), AAC(2)). ED50 is 7.5-15 mg/kg (abdominal infection in mice, intravenous administration).
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02899 |
| Pricing | Inquire |
| Cas | 56276-26-7 |
| Molecular Weight | 450.53 |
| Molecular Formula | C18H38N6O7 |
| Canonical SMILES | COC1COC(C(C1N)N)OC2C(CC(C(C2O)OC3C(C(CC(O3)CN)O)N)N)N |