L-Iduronic acid
L-Iduronic acid, a highly significant compound prevalent in the biomedical field, finds extensive application. In the pursuit of combating diverse ailments like cancer, cardiovascular diseases, and inflammatory disorders, this compound serves as an indispensable component for drug synthesis. Its remarkable attributes render it crucial for formulating drug delivery systems that augment therapeutic efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2073-35-0 |
| Pricing | Inquire |
| Cas | 2073-35-0 |
| Molecular Weight | 194.14 |
| Molecular Formula | C6H10O7 |
| Canonical SMILES | C(=O)C(C(C(C(C(=O)O)O)O)O)O |