Ezetimibe Deprotected Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L13) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1185883-40-2 |
| Pricing | Inquire |
| Cas | 1185883-40-2 |
| Molecular Weight | 572.61 |
| Molecular Formula | C33H30F2N2O5 |
| Canonical SMILES | C1C(N(C(=O)O1)C(=O)C(CCC(C2=CC=C(C=C2)F)O)C(C3=CC=C(C=C3)O)NC4=CC=C(C=C4)F)C5=CC=CC=C5 |