Desethyl Chloroquine-[d4]
Desethyl Chloroquine-[d4] is the labelled analogue of Desethyl Chloroquine, which is a metabolite of Chloroquine. Chloroquine is a medication primarily used to prevent and treat malaria in areas where malaria remains sensitive to its effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012826 |
| Pricing | Inquire |
| Cas | 1189971-72-9 |
| Molecular Weight | 295.85 |
| Molecular Formula | C16H18D4ClN3 |
| Canonical SMILES | CCNCCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl |