Fexofenadine EP Impurity G
Fexofenadine EP Impurity G is an impurity of Fexofenadine, which is a histamine H1 receptor antagonist used for the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-471577 |
| Pricing | Inquire |
| Cas | 1187954-57-9 |
| Molecular Weight | 483.66 |
| Molecular Formula | C32H37NO3 |
| Canonical SMILES | CC(C)(C1=CC=C(C=C1)C(CCCN2CCC(=C(C3=CC=CC=C3)C4=CC=CC=C4)CC2)O)C(=O)O |