N-Methyl Pantoprazole-[d3] (Mixture of 1 and 3 isomers)
N-Methyl Pantoprazole-[d3] (Mixture of 1 and 3 isomers) is a labelled impurity of Pantoprazole which is used to treat erosive esophagitis (damage to the esophagus from stomach acid), and other conditions involving excess stomach acid such as Zollinger-Ellison syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007782 |
| Pricing | Inquire |
| Cas | 1190008-84-4 |
| Molecular Weight | 400.41 |
| Molecular Formula | C17H14D3F2N3O4S |
| Canonical SMILES | CN1C2=C(C=C(C=C2)OC(F)F)N=C1S(=O)CC3=NC=CC(=C3OC)OC |