(3-acrylamidopropyl)trimethylammonium chloride
(3-acrylamidopropyl)trimethylammonium chloride is a quaternary ammonium compound. Due to its potent antimicrobial properties, it is widely used in the study of infectious diseases associated with pathogenic microorganisms, including bacteria, fungi, and viruses.
Supplier | BOC Sciences |
---|---|
Product # | 45021-77-0 |
Pricing | Inquire |
Cas | 45021-77-0 |
Molecular Weight | 206.715 |
Molecular Formula | C9H19N2O?Cl |
Canonical SMILES | C[N+](C)(C)CCCNC(=O)C=C.[Cl-] |