6-Methyl-3-(β-D-2-deoxyribofuranosyl)furano-[2,3-d]pyrimidin-2-one
6-Methyl-3-(β-D-2-deoxyribofuranosyl)furano-[2,3-d]pyrimidin-2-one, an exceptional compound employed in biomedicine, showcases significant potential as a formidable antiviral agent. Its efficacy extends to combatting a multitude of viral afflictions, including the nefarious herpes simplex virus and the debilitating human immunodeficiency virus (HIV). By specifically targeting viral DNA synthesis, this compound adeptly impedes viral replication, thereby accentuating its stature as an indispensable instrument in the advancement of antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383897-60-7 |
| Pricing | Inquire |
| Cas | 383897-60-7 |
| Molecular Weight | 266.24 |
| Molecular Formula | C12H14N2O5 |
| Canonical SMILES | CC1=CC2=CN(C(=O)N=C2O1)C3CC(C(O3)CO)O |