5-Methoxyuridine 5'-triphosphate
5-Methoxyuridine 5'-triphosphate is a vital component used in the biomedical industry for various applications serving as a key building block in the research and development of RNA molecules for research purposes. Additionally, it plays a significant role in studying RNA post-transcriptional modifications and RNA labeling techniques. Its incorporation supports investigations related to drug discovery, gene expression profiling and disease understanding.
| Supplier | BOC Sciences |
|---|---|
| Product # | 847649-65-4 |
| Pricing | Inquire |
| Cas | 847649-65-4 |
| Molecular Weight | 514.17 |
| Molecular Formula | C10H17N2O16P3 |
| Canonical SMILES | COC1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |