HIV-1-inhibitor-19
HIV-1 inhibitor-19 is a potent HIV-1 non-nucleoside reverse transcriptase inhibitor (NNRTI). HIV-1 inhibitor-19 maintains its inhibitory activity against L100I, K103N and V106A/ F227L mutant strains with EC50s of 7.3 nM, 9.2 nM and 21.0 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2649837-82-9 |
| Pricing | Inquire |
| Cas | 2649837-82-9 |
| Molecular Weight | 496.77 |
| Molecular Formula | C24H22BClN2O5S |
| Canonical SMILES | B(C1=CC(=CC=C1)CNC(=O)C2=C(C3=C(N2)C=CC(=C3)Cl)S(=O)(=O)C4=CC(=CC(=C4)C)C)(O)O |