5-Chloroisatoic Anhydride
5-Chloroisatoic Anhydride was used as a reagent in the synthesis of 2-acetamidobenzamides bearing the 2-phenoxy functionality which display antiproliferative activity against certain tumor cell lines. Also used in the preparation of inhibitors of delta-5 desaturase.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB026280 |
| Pricing | Inquire |
| Cas | 4743-17-3 |
| Molecular Weight | 197.58 |
| Molecular Formula | C8H4ClNO3 |
| Canonical SMILES | C1=CC2=C(C=C1Cl)C(=O)OC(=O)N2 |